C25H30ClFN4O4 — CID 87760524
1-(2-aminoacetyl)-N-[(4-chloro-2-fluorophenyl)methyl]-4-[(4-ethyl-N-formylanilino)oxymethyl]piperidine-4-carboxamide (PubChem CID 87760524) has the molecular formula C25H30ClFN4O4 and a molecular weight of 504.99 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N-[(4-chloro-2-fluorophenyl)methyl]-4-[(4-ethyl-N-formylanilino)oxymethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-aminoacetyl)-N-[(4-chloro-2-fluorophenyl)methyl]-4-[(4-ethyl-N-formylanilino)oxymethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87760524 |
| Molecular Formula | C25H30ClFN4O4 |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-(2-aminoacetyl)-N-[(4-chloro-2-fluorophenyl)methyl]-4-[(4-ethyl-N-formylanilino)oxymethyl]piperidine-4-carboxamide |
| SMILES | CCc1ccc(N(C=O)OCC2(C(=O)NCc3ccc(Cl)cc3F)CCN(C(=O)CN)CC2)cc1 |
| InChI | InChI=1S/C25H30ClFN4O4/c1-2-18-3-7-21(8-4-18)31(17-32)35-16-25(9-11-30(12-10-25)23(33)14-28)24(34)29-15-19-5-6-20(26)13-22(19)27/h3-8,13,17H,2,9-12,14-16,28H2,1H3,(H,29,34) |
| InChIKey | GTUWUZKSIHFLNF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|