C25H25F6N3O3 — CID 87762012
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-3-(3-methylphenyl)-1-oxamoylpiperidine-4-carboxamide (PubChem CID 87762012) has the molecular formula C25H25F6N3O3 and a molecular weight of 529.48 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-3-(3-methylphenyl)-1-oxamoylpiperidine-4-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-3-(3-methylphenyl)-1-oxamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 87762012 |
| Molecular Formula | C25H25F6N3O3 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-3-(3-methylphenyl)-1-oxamoylpiperidine-4-carboxamide |
| SMILES | Cc1cccc(C2CN(C(=O)C(N)=O)CCC2C(=O)N(C)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H25F6N3O3/c1-14-4-3-5-16(8-14)20-13-34(23(37)21(32)35)7-6-19(20)22(36)33(2)12-15-9-17(24(26,27)28)11-18(10-15)25(29,30)31/h3-5,8-11,19-20H,6-7,12-13H2,1-2H3,(H2,32,35) |
| InChIKey | DPFGGPABPYQDSH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|