C11H21F3O4SSi — CID 87764998
tri(propan-2-yl)silyl 2,2-difluoro-2-fluorosulfonylacetate (PubChem CID 87764998) has the molecular formula C11H21F3O4SSi and a molecular weight of 334.43 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 2,2-difluoro-2-fluorosulfonylacetate.
| Compound Name | tri(propan-2-yl)silyl 2,2-difluoro-2-fluorosulfonylacetate |
|---|---|
| PubChem CID | 87764998 |
| Molecular Formula | C11H21F3O4SSi |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | tri(propan-2-yl)silyl 2,2-difluoro-2-fluorosulfonylacetate |
| SMILES | CC(C)[Si](OC(=O)C(F)(F)S(=O)(=O)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C11H21F3O4SSi/c1-7(2)20(8(3)4,9(5)6)18-10(15)11(12,13)19(14,16)17/h7-9H,1-6H3 |
| InChIKey | ZAROGEPWBCFZES-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|