C12H14ClNOS — CID 87766572
2-[2-(4-chlorophenyl)morpholin-4-yl]ethanethial (PubChem CID 87766572) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]ethanethial.
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethanethial |
|---|---|
| PubChem CID | 87766572 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethanethial |
| SMILES | S=CCN1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H14ClNOS/c13-11-3-1-10(2-4-11)12-9-14(6-8-16)5-7-15-12/h1-4,8,12H,5-7,9H2 |
| InChIKey | FLTMRFWAKFHORD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|