C17H26N3O3+ — CID 8776758
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate (PubChem CID 8776758) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8776758 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)c1ccc[nH+]c1N1CCCC1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-7-13(2)19-15(21)12-23-17(22)14-8-6-9-18-16(14)20-10-4-5-11-20/h6,8-9,13H,3-5,7,10-12H2,1-2H3,(H,19,21)/p+1/t13-/m0/s1 |
| InChIKey | ZJLDLEIQMPEDEV-ZDUSSCGKSA-O |
| XLogP | 1.56 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |