C21H25N2O4+ — CID 8006400
[(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate (PubChem CID 8006400) has the molecular formula C21H25N2O4+ and a molecular weight of 369.44 g/mol. Its IUPAC name is [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate.
| Compound Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 8006400 |
| Molecular Formula | C21H25N2O4+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-pyrrolidin-1-ylpyridin-1-ium-3-carboxylate |
| SMILES | CCOc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc[nH+]c2N2CCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-26-17-10-8-16(9-11-17)19(24)15(2)27-21(25)18-7-6-12-22-20(18)23-13-4-5-14-23/h6-12,15H,3-5,13-14H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | CLYDNDJUVFUCBF-OAHLLOKOSA-O |
| XLogP | 2.93 |
| TPSA | 69.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |