C12H27NO3 — CID 87769909
4-(1-hydroxybutylamino)-4-methylheptane-3,5-diol (PubChem CID 87769909) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-(1-hydroxybutylamino)-4-methylheptane-3,5-diol.
| Compound Name | 4-(1-hydroxybutylamino)-4-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 87769909 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 4-(1-hydroxybutylamino)-4-methylheptane-3,5-diol |
| SMILES | CCCC(O)NC(C)(C(O)CC)C(O)CC |
| InChI | InChI=1S/C12H27NO3/c1-5-8-11(16)13-12(4,9(14)6-2)10(15)7-3/h9-11,13-16H,5-8H2,1-4H3 |
| InChIKey | WCWMVFYXNFTONJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|