C6H15O12P3S3 — CID 87772008
[hydroxy-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methoxy]phosphoryl] trithiophosphono hydrogen phosphate (PubChem CID 87772008) has the molecular formula C6H15O12P3S3 and a molecular weight of 468.30 g/mol. Its IUPAC name is [hydroxy-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methoxy]phosphoryl] trithiophosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methoxy]phosphoryl] trithiophosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87772008 |
| Molecular Formula | C6H15O12P3S3 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.89 |
| IUPAC Name | [hydroxy-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methoxy]phosphoryl] trithiophosphono hydrogen phosphate |
| SMILES | O=P(O)(OCC1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O)OP(=O)(O)OP(=S)(S)S |
| InChI | InChI=1S/C6H15O12P3S3/c7-3-1-15-6(10,5(9)4(3)8)2-16-19(11,12)17-20(13,14)18-21(22,23)24/h3-5,7-10H,1-2H2,(H,11,12)(H,13,14)(H2,22,23,24)/t3-,4-,5+,6?/m1/s1 |
| InChIKey | QSGRRIQZKMMCJC-VRPWFDPXSA-N |
| XLogP | -0.88 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|