C6H15O15P3 — CID 87772041
[hydroxy(phosphonooxy)phosphoryl] [(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate (PubChem CID 87772041) has the molecular formula C6H15O15P3 and a molecular weight of 420.09 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl] [(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl] [(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 87772041 |
| Molecular Formula | C6H15O15P3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl] [(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H15O15P3/c7-3-1-18-6(10,5(9)4(3)8)2-19-23(14,15)21-24(16,17)20-22(11,12)13/h3-5,7-10H,1-2H2,(H,14,15)(H,16,17)(H2,11,12,13)/t3-,4-,5+,6?/m1/s1 |
| InChIKey | XZRKDXCCBOULBH-VRPWFDPXSA-N |
| XLogP | -2.87 |
| TPSA | 249.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|