C51H54Cl2Zr — CID 87772501
CID 87772501 (PubChem CID 87772501) has the molecular formula C51H54Cl2Zr and a molecular weight of 829.12 g/mol.
| Compound Name | CID 87772501 |
|---|---|
| PubChem CID | 87772501 |
| Molecular Formula | C51H54Cl2Zr |
| Molecular Weight | 829.12 g/mol |
| Exact Mass | 826.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C(C)(C)C)=CC5(C)C.CC1=CC(C)[C-]=C1.Clc1cccc(C(=[Zr+2])c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C31H37.C13H8Cl2.C7H9.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;14-12-5-1-3-10(8-12)7-11-4-2-6-13(15)9-11;1-6-3-4-7(2)5-6;/h11-17H,1-10H3;1-6,8-9H;3,5,7H,1-2H3;/q-1;;-1;+2 |
| InChIKey | KAUSTEBQMFBLLC-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.12 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|