About CID 87772501
CID 87772501 (PubChem CID 87772501) has the molecular formula C51H54Cl2Zr
and a molecular weight of 829.12 g/mol.
Molecular Properties
| Compound Name | CID 87772501 |
| PubChem CID | 87772501 |
| Molecular Formula | C51H54Cl2Zr |
| Molecular Weight | 829.12 g/mol |
| Exact Mass | 826.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C(C)(C)C)=CC5(C)C.CC1=CC(C)[C-]=C1.Clc1cccc(C(=[Zr+2])c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C31H37.C13H8Cl2.C7H9.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;14-12-5-1-3-10(8-12)7-11-4-2-6-13(15)9-11;1-6-3-4-7(2)5-6;/h11-17H,1-10H3;1-6,8-9H;3,5,7H,1-2H3;/q-1;;-1;+2 |
| InChIKey | KAUSTEBQMFBLLC-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 829.12 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 87772501 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87772501?
The IUPAC name of CID 87772501 (CID 87772501) is not available.
What is the SMILES notation for CID 87772501?
The canonical SMILES for CID 87772501 is CC(C)(C)C1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C(C)(C)C)=CC5(C)C.CC1=CC(C)[C-]=C1.Clc1cccc(C(=[Zr+2])c2cccc(Cl)c2)c1.
What is the InChIKey of CID 87772501?
The InChIKey is KAUSTEBQMFBLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H37.C13H8Cl2.C7H9.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;14-12-5-1-3-10(8-12)7-11-4-2-6-13(15)9-11;1-6-3-4-7(2)5-6;/h11-17H,1-10H3;1-6,8-9H;3,5,7H,1-2H3;/q-1;;-1;+2.
What are the key properties of CID 87772501?
CID 87772501 has a molecular weight of 829.12 g/mol, XLogP of 15.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87772501 is sourced from PubChem (CID 87772501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).