C56H66Zr — CID 173156261
CID 173156261 (PubChem CID 173156261) has the molecular formula C56H66Zr and a molecular weight of 830.37 g/mol.
| Compound Name | CID 173156261 |
|---|---|
| PubChem CID | 173156261 |
| Molecular Formula | C56H66Zr |
| Molecular Weight | 830.37 g/mol |
| Exact Mass | 828.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C(C)(C)C)=CC5(C)C.CC1[C-]=CC(C(C)(C)C)=C1.Cc1ccc(C(=[Zr+2])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H37.C15H14.C10H15.Zr/c1-28(2,3)26-16-30(7,8)24-12-18-11-19-13-25-23(15-21(19)20(18)14-22(24)26)27(29(4,5)6)17-31(25,9)10;1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-8-5-6-9(7-8)10(2,3)4;/h11-17H,1-10H3;3-10H,1-2H3;6-8H,1-4H3;/q-1;;-1;+2 |
| InChIKey | QQWGTLFKDACJBL-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.37 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|