About [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol
[3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol (PubChem CID 87773315) has the molecular formula C6H12S4
and a molecular weight of 212.43 g/mol. Its IUPAC name is [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol.
Molecular Properties
| Compound Name | [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol |
| PubChem CID | 87773315 |
| Molecular Formula | C6H12S4 |
| Molecular Weight | 212.43 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol |
| SMILES | SCC1SCCSC1CS |
| InChI | InChI=1S/C6H12S4/c7-3-5-6(4-8)10-2-1-9-5/h5-8H,1-4H2 |
| InChIKey | FGXPGNMXPDQBHV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The IUPAC name of [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol (CID 87773315) is [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol.
What is the SMILES notation for [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The canonical SMILES for [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol is SCC1SCCSC1CS.
What is the InChIKey of [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
The InChIKey is FGXPGNMXPDQBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12S4/c7-3-5-6(4-8)10-2-1-9-5/h5-8H,1-4H2.
What are the key properties of [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol?
[3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol has a molecular weight of 212.43 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(sulfanylmethyl)-1,4-dithian-2-yl]methanethiol is sourced from PubChem (CID 87773315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).