C10H14O2 — CID 87775097
[(1E)-2-methylbuta-1,3-dienyl] 2-methylidenebutanoate (PubChem CID 87775097) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is [(1E)-2-methylbuta-1,3-dienyl] 2-methylidenebutanoate.
| Compound Name | [(1E)-2-methylbuta-1,3-dienyl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 87775097 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | [(1E)-2-methylbuta-1,3-dienyl] 2-methylidenebutanoate |
| SMILES | C=C/C(C)=C/OC(=O)C(=C)CC |
| InChI | InChI=1S/C10H14O2/c1-5-8(3)7-12-10(11)9(4)6-2/h5,7H,1,4,6H2,2-3H3/b8-7+ |
| InChIKey | RBOPQDRGMMTKOU-BQYQJAHWSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|