C20H21NO4 — CID 8777520
5-methoxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 8777520) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-methoxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | 5-methoxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 8777520 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-methoxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCCc3ccccc32)cc2c1OCCO2 |
| InChI | InChI=1S/C20H21NO4/c1-23-17-11-14(12-18-19(17)25-10-9-24-18)20(22)21-16-8-4-6-13-5-2-3-7-15(13)16/h2-3,5,7,11-12,16H,4,6,8-10H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | ZUGASXLTZKFPOA-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |