C22H35OSiTi — CID 87777313
2-tert-butylcyclopenta-1,3-diene;3-methyl-5-trimethylsilylphenol;propan-2-ylidenetitanium(1+) (PubChem CID 87777313) has the molecular formula C22H35OSiTi and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-tert-butylcyclopenta-1,3-diene;3-methyl-5-trimethylsilylphenol;propan-2-ylidenetitanium(1+).
| Compound Name | 2-tert-butylcyclopenta-1,3-diene;3-methyl-5-trimethylsilylphenol;propan-2-ylidenetitanium(1+) |
|---|---|
| PubChem CID | 87777313 |
| Molecular Formula | C22H35OSiTi |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-tert-butylcyclopenta-1,3-diene;3-methyl-5-trimethylsilylphenol;propan-2-ylidenetitanium(1+) |
| SMILES | CC(C)(C)C1=[C-]CC=C1.CC(C)=[Ti+].Cc1cc(O)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C10H16OSi.C9H13.C3H6.Ti/c1-8-5-9(11)7-10(6-8)12(2,3)4;1-9(2,3)8-6-4-5-7-8;1-3-2;/h5-7,11H,1-4H3;4,6H,5H2,1-3H3;1-2H3;/q;-1;;+1 |
| InChIKey | JSNDHMBHTQNTHF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|