About triheptyl(nonyl)azanium iodide
triheptyl(nonyl)azanium iodide (PubChem CID 87778959) has the molecular formula C30H64IN
and a molecular weight of 565.75 g/mol. Its IUPAC name is triheptyl(nonyl)azanium iodide.
Molecular Properties
| Compound Name | triheptyl(nonyl)azanium iodide |
| PubChem CID | 87778959 |
| Molecular Formula | C30H64IN |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | triheptyl(nonyl)azanium iodide |
| SMILES | CCCCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[I-] |
| InChI | InChI=1S/C30H64N.HI/c1-5-9-13-17-18-22-26-30-31(27-23-19-14-10-6-2,28-24-20-15-11-7-3)29-25-21-16-12-8-4;/h5-30H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | BURODNJGIVPRNA-UHFFFAOYSA-M |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triheptyl(nonyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triheptyl(nonyl)azanium iodide?
The IUPAC name of triheptyl(nonyl)azanium iodide (CID 87778959) is triheptyl(nonyl)azanium iodide.
What is the SMILES notation for triheptyl(nonyl)azanium iodide?
The canonical SMILES for triheptyl(nonyl)azanium iodide is CCCCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[I-].
What is the InChIKey of triheptyl(nonyl)azanium iodide?
The InChIKey is BURODNJGIVPRNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H64N.HI/c1-5-9-13-17-18-22-26-30-31(27-23-19-14-10-6-2,28-24-20-15-11-7-3)29-25-21-16-12-8-4;/h5-30H2,1-4H3;1H/q+1;/p-1.
What are the key properties of triheptyl(nonyl)azanium iodide?
triheptyl(nonyl)azanium iodide has a molecular weight of 565.75 g/mol, XLogP of 7.47, 26 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triheptyl(nonyl)azanium iodide is sourced from PubChem (CID 87778959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).