C16H10ClF4NO3 — CID 87780323
[5-chloro-2-(4-fluoro-3-methylphenyl)phenyl]carbamoyl 2,2,2-trifluoroacetate (PubChem CID 87780323) has the molecular formula C16H10ClF4NO3 and a molecular weight of 375.71 g/mol. Its IUPAC name is [5-chloro-2-(4-fluoro-3-methylphenyl)phenyl]carbamoyl 2,2,2-trifluoroacetate.
| Compound Name | [5-chloro-2-(4-fluoro-3-methylphenyl)phenyl]carbamoyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87780323 |
| Molecular Formula | C16H10ClF4NO3 |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | [5-chloro-2-(4-fluoro-3-methylphenyl)phenyl]carbamoyl 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(-c2ccc(Cl)cc2NC(=O)OC(=O)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C16H10ClF4NO3/c1-8-6-9(2-5-12(8)18)11-4-3-10(17)7-13(11)22-15(24)25-14(23)16(19,20)21/h2-7H,1H3,(H,22,24) |
| InChIKey | WQKXOVJQMHWUAB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|