C17H21N3O2 — CID 87780608
N'-[3-(4-nitro-2-phenylphenyl)propyl]ethane-1,2-diamine (PubChem CID 87780608) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N'-[3-(4-nitro-2-phenylphenyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(4-nitro-2-phenylphenyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 87780608 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N'-[3-(4-nitro-2-phenylphenyl)propyl]ethane-1,2-diamine |
| SMILES | NCCNCCCc1ccc([N+](=O)[O-])cc1-c1ccccc1 |
| InChI | InChI=1S/C17H21N3O2/c18-10-12-19-11-4-7-15-8-9-16(20(21)22)13-17(15)14-5-2-1-3-6-14/h1-3,5-6,8-9,13,19H,4,7,10-12,18H2 |
| InChIKey | FYXQSYPMKSSGPV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|