C26H25ClN4O4S — CID 91596036
N-[2-[3-(2-chloro-4-nitrophenyl)propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide (PubChem CID 91596036) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is N-[2-[3-(2-chloro-4-nitrophenyl)propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide.
| Compound Name | N-[2-[3-(2-chloro-4-nitrophenyl)propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 91596036 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | N-[2-[3-(2-chloro-4-nitrophenyl)propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(CCCNCCNS(=O)(=O)c2cc(-c3ccccc3)cc3cnccc23)c(Cl)c1 |
| InChI | InChI=1S/C26H25ClN4O4S/c27-25-17-23(31(32)33)9-8-20(25)7-4-11-28-13-14-30-36(34,35)26-16-21(19-5-2-1-3-6-19)15-22-18-29-12-10-24(22)26/h1-3,5-6,8-10,12,15-18,28,30H,4,7,11,13-14H2 |
| InChIKey | HWQIYNZLOSMSEY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|