C31H36ClN5O2S — CID 91562727
N-[2-[3-[4-chloro-2-(3-methylpiperazin-1-yl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide (PubChem CID 91562727) has the molecular formula C31H36ClN5O2S and a molecular weight of 578.18 g/mol. Its IUPAC name is N-[2-[3-[4-chloro-2-(3-methylpiperazin-1-yl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide.
| Compound Name | N-[2-[3-[4-chloro-2-(3-methylpiperazin-1-yl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 91562727 |
| Molecular Formula | C31H36ClN5O2S |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | N-[2-[3-[4-chloro-2-(3-methylpiperazin-1-yl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
| SMILES | CC1CN(c2cc(Cl)ccc2CCCNCCNS(=O)(=O)c2cc(-c3ccccc3)cc3cnccc23)CCN1 |
| InChI | InChI=1S/C31H36ClN5O2S/c1-23-22-37(17-16-35-23)30-20-28(32)10-9-25(30)8-5-12-33-14-15-36-40(38,39)31-19-26(24-6-3-2-4-7-24)18-27-21-34-13-11-29(27)31/h2-4,6-7,9-11,13,18-21,23,33,35-36H,5,8,12,14-17,22H2,1H3 |
| InChIKey | RQXXRLBJLRDZCD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|