C27H29N3O5S2 — CID 58816132
N-[3-[2-(4-methylsulfonylphenoxy)ethylamino]propyl]-7-phenylisoquinoline-5-sulfonamide (PubChem CID 58816132) has the molecular formula C27H29N3O5S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[3-[2-(4-methylsulfonylphenoxy)ethylamino]propyl]-7-phenylisoquinoline-5-sulfonamide.
| Compound Name | N-[3-[2-(4-methylsulfonylphenoxy)ethylamino]propyl]-7-phenylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 58816132 |
| Molecular Formula | C27H29N3O5S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[3-[2-(4-methylsulfonylphenoxy)ethylamino]propyl]-7-phenylisoquinoline-5-sulfonamide |
| SMILES | CS(=O)(=O)c1ccc(OCCNCCCNS(=O)(=O)c2cc(-c3ccccc3)cc3cnccc23)cc1 |
| InChI | InChI=1S/C27H29N3O5S2/c1-36(31,32)25-10-8-24(9-11-25)35-17-16-28-13-5-14-30-37(33,34)27-19-22(21-6-3-2-4-7-21)18-23-20-29-15-12-26(23)27/h2-4,6-12,15,18-20,28,30H,5,13-14,16-17H2,1H3 |
| InChIKey | YGAMUQJQFMUKJJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|