C20H22BrN3O3S — CID 58816130
N-[2-[2-(2-bromo-4-methylphenoxy)ethylamino]ethyl]isoquinoline-5-sulfonamide (PubChem CID 58816130) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[2-[2-(2-bromo-4-methylphenoxy)ethylamino]ethyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[2-[2-(2-bromo-4-methylphenoxy)ethylamino]ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 58816130 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[2-[2-(2-bromo-4-methylphenoxy)ethylamino]ethyl]isoquinoline-5-sulfonamide |
| SMILES | Cc1ccc(OCCNCCNS(=O)(=O)c2cccc3cnccc23)c(Br)c1 |
| InChI | InChI=1S/C20H22BrN3O3S/c1-15-5-6-19(18(21)13-15)27-12-11-22-9-10-24-28(25,26)20-4-2-3-16-14-23-8-7-17(16)20/h2-8,13-14,22,24H,9-12H2,1H3 |
| InChIKey | IKFSSUDPPDUXGN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|