C14H19N3O3S — CID 106308158
N-[3-(2-aminoethoxy)propyl]isoquinoline-5-sulfonamide (PubChem CID 106308158) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 106308158 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]isoquinoline-5-sulfonamide |
| SMILES | NCCOCCCNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C14H19N3O3S/c15-6-10-20-9-2-7-17-21(18,19)14-4-1-3-12-11-16-8-5-13(12)14/h1,3-5,8,11,17H,2,6-7,9-10,15H2 |
| InChIKey | AXZYDNJRYXCWGG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|