C24H29N3O5S — CID 57202541
N-[2-[[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide (PubChem CID 57202541) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[2-[[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[2-[[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 57202541 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[2-[[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enyl]amino]ethyl]isoquinoline-5-sulfonamide |
| SMILES | COc1cc(C=C(C)CNCCNS(=O)(=O)c2cccc3cnccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H29N3O5S/c1-17(12-18-13-21(30-2)24(32-4)22(14-18)31-3)15-26-10-11-27-33(28,29)23-7-5-6-19-16-25-9-8-20(19)23/h5-9,12-14,16,26-27H,10-11,15H2,1-4H3 |
| InChIKey | MMZVFGJCDVEPNH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|