C49H49N3O6S — CID 142955486
N-[2-[3-(2-benzyl-4-methylphenoxy)propyl-[bis(4-methoxyphenyl)methyl]amino]ethyl]-7-(3-hydroxyphenyl)isoquinoline-5-sulfonamide (PubChem CID 142955486) has the molecular formula C49H49N3O6S and a molecular weight of 808.01 g/mol. Its IUPAC name is N-[2-[3-(2-benzyl-4-methylphenoxy)propyl-[bis(4-methoxyphenyl)methyl]amino]ethyl]-7-(3-hydroxyphenyl)isoquinoline-5-sulfonamide.
| Compound Name | N-[2-[3-(2-benzyl-4-methylphenoxy)propyl-[bis(4-methoxyphenyl)methyl]amino]ethyl]-7-(3-hydroxyphenyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 142955486 |
| Molecular Formula | C49H49N3O6S |
| Molecular Weight | 808.01 g/mol |
| Exact Mass | 807.33 |
| IUPAC Name | N-[2-[3-(2-benzyl-4-methylphenoxy)propyl-[bis(4-methoxyphenyl)methyl]amino]ethyl]-7-(3-hydroxyphenyl)isoquinoline-5-sulfonamide |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N(CCCOc2ccc(C)cc2Cc2ccccc2)CCNS(=O)(=O)c2cc(-c3cccc(O)c3)cc3cnccc23)cc1 |
| InChI | InChI=1S/C49H49N3O6S/c1-35-13-22-47(41(29-35)30-36-9-5-4-6-10-36)58-28-8-26-52(49(37-14-18-44(56-2)19-15-37)38-16-20-45(57-3)21-17-38)27-25-51-59(54,55)48-33-40(39-11-7-12-43(53)32-39)31-42-34-50-24-23-46(42)48/h4-7,9-24,29,31-34,49,51,53H,8,25-28,30H2,1-3H3 |
| InChIKey | BCDVXXOPIZSZCL-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.01 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|