C27H28Cl2F2N4O4S — CID 131727178
7-[3-(difluoromethyl)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide;dihydrochloride (PubChem CID 131727178) has the molecular formula C27H28Cl2F2N4O4S and a molecular weight of 613.51 g/mol. Its IUPAC name is 7-[3-(difluoromethyl)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide;dihydrochloride.
| Compound Name | 7-[3-(difluoromethyl)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 131727178 |
| Molecular Formula | C27H28Cl2F2N4O4S |
| Molecular Weight | 613.51 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | 7-[3-(difluoromethyl)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc(CCCNCCNS(=O)(=O)c2cc(-c3cccc(C(F)F)c3)cc3cnccc23)cc1 |
| InChI | InChI=1S/C27H26F2N4O4S.2ClH/c28-27(29)21-5-1-4-20(15-21)22-16-23-18-31-12-10-25(23)26(17-22)38(36,37)32-14-13-30-11-2-3-19-6-8-24(9-7-19)33(34)35;;/h1,4-10,12,15-18,27,30,32H,2-3,11,13-14H2;2*1H |
| InChIKey | RPNQGBCZQCPGIX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|