C27H29N5O6S2 — CID 58812030
7-[3-(methanesulfonamido)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide (PubChem CID 58812030) has the molecular formula C27H29N5O6S2 and a molecular weight of 583.69 g/mol. Its IUPAC name is 7-[3-(methanesulfonamido)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide.
| Compound Name | 7-[3-(methanesulfonamido)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 58812030 |
| Molecular Formula | C27H29N5O6S2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 7-[3-(methanesulfonamido)phenyl]-N-[2-[3-(4-nitrophenyl)propylamino]ethyl]isoquinoline-5-sulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cc(S(=O)(=O)NCCNCCCc3ccc([N+](=O)[O-])cc3)c3ccncc3c2)c1 |
| InChI | InChI=1S/C27H29N5O6S2/c1-39(35,36)31-24-6-2-5-21(17-24)22-16-23-19-29-13-11-26(23)27(18-22)40(37,38)30-15-14-28-12-3-4-20-7-9-25(10-8-20)32(33)34/h2,5-11,13,16-19,28,30-31H,3-4,12,14-15H2,1H3 |
| InChIKey | LWUKUNYGIHBEOI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 160.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|