C29H34N6O6S2 — CID 139719816
N-[4-[2-[[6-(methanesulfonamido)-4-[2-(4-nitrophenyl)ethylamino]quinolin-2-yl]methyl-methylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 139719816) has the molecular formula C29H34N6O6S2 and a molecular weight of 626.76 g/mol. Its IUPAC name is N-[4-[2-[[6-(methanesulfonamido)-4-[2-(4-nitrophenyl)ethylamino]quinolin-2-yl]methyl-methylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[[6-(methanesulfonamido)-4-[2-(4-nitrophenyl)ethylamino]quinolin-2-yl]methyl-methylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 139719816 |
| Molecular Formula | C29H34N6O6S2 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | N-[4-[2-[[6-(methanesulfonamido)-4-[2-(4-nitrophenyl)ethylamino]quinolin-2-yl]methyl-methylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | CN(CCc1ccc(NS(C)(=O)=O)cc1)Cc1cc(NCCc2ccc([N+](=O)[O-])cc2)c2cc(NS(C)(=O)=O)ccc2n1 |
| InChI | InChI=1S/C29H34N6O6S2/c1-34(17-15-22-4-8-23(9-5-22)32-42(2,38)39)20-25-19-29(30-16-14-21-6-11-26(12-7-21)35(36)37)27-18-24(33-43(3,40)41)10-13-28(27)31-25/h4-13,18-19,32-33H,14-17,20H2,1-3H3,(H,30,31) |
| InChIKey | HNVXURHMJNHICL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 163.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|