C31H32N4O6S — CID 69310839
tert-butyl N-[(E)-3-(4-nitrophenyl)prop-2-enyl]-N-[2-[(7-phenylisoquinolin-5-yl)sulfonylamino]ethyl]carbamate (PubChem CID 69310839) has the molecular formula C31H32N4O6S and a molecular weight of 588.69 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-(4-nitrophenyl)prop-2-enyl]-N-[2-[(7-phenylisoquinolin-5-yl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-(4-nitrophenyl)prop-2-enyl]-N-[2-[(7-phenylisoquinolin-5-yl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 69310839 |
| Molecular Formula | C31H32N4O6S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | tert-butyl N-[(E)-3-(4-nitrophenyl)prop-2-enyl]-N-[2-[(7-phenylisoquinolin-5-yl)sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C/C=C/c1ccc([N+](=O)[O-])cc1)CCNS(=O)(=O)c1cc(-c2ccccc2)cc2cnccc12 |
| InChI | InChI=1S/C31H32N4O6S/c1-31(2,3)41-30(36)34(18-7-8-23-11-13-27(14-12-23)35(37)38)19-17-33-42(39,40)29-21-25(24-9-5-4-6-10-24)20-26-22-32-16-15-28(26)29/h4-16,20-22,33H,17-19H2,1-3H3/b8-7+ |
| InChIKey | OWEHKTQPGIUFBV-BQYQJAHWSA-N |
| XLogP | 6.04 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|