C30H32N5O6S- — CID 69313553
5-[2-[(2-methylpropan-2-yl)oxycarbonyl-[3-(4-nitrophenyl)propyl]amino]ethyl-sulfinatoamino]-7-pyridin-3-ylisoquinoline (PubChem CID 69313553) has the molecular formula C30H32N5O6S- and a molecular weight of 590.68 g/mol. Its IUPAC name is 5-[2-[(2-methylpropan-2-yl)oxycarbonyl-[3-(4-nitrophenyl)propyl]amino]ethyl-sulfinatoamino]-7-pyridin-3-ylisoquinoline.
| Compound Name | 5-[2-[(2-methylpropan-2-yl)oxycarbonyl-[3-(4-nitrophenyl)propyl]amino]ethyl-sulfinatoamino]-7-pyridin-3-ylisoquinoline |
|---|---|
| PubChem CID | 69313553 |
| Molecular Formula | C30H32N5O6S- |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 5-[2-[(2-methylpropan-2-yl)oxycarbonyl-[3-(4-nitrophenyl)propyl]amino]ethyl-sulfinatoamino]-7-pyridin-3-ylisoquinoline |
| SMILES | CC(C)(C)OC(=O)N(CCCc1ccc([N+](=O)[O-])cc1)CCN(c1cc(-c2cccnc2)cc2cnccc12)S(=O)[O-] |
| InChI | InChI=1S/C30H33N5O6S/c1-30(2,3)41-29(36)33(15-5-6-22-8-10-26(11-9-22)35(37)38)16-17-34(42(39)40)28-19-24(23-7-4-13-31-20-23)18-25-21-32-14-12-27(25)28/h4,7-14,18-21H,5-6,15-17H2,1-3H3,(H,39,40)/p-1 |
| InChIKey | DDXUYKXRPUXKEM-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 141.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|