C26H24N3O6S- — CID 90937322
5-[[4,5-dihydroxy-5-(4-nitrophenyl)pentan-2-yl]-sulfinatoamino]-7-phenylisoquinoline (PubChem CID 90937322) has the molecular formula C26H24N3O6S- and a molecular weight of 506.56 g/mol. Its IUPAC name is 5-[[4,5-dihydroxy-5-(4-nitrophenyl)pentan-2-yl]-sulfinatoamino]-7-phenylisoquinoline.
| Compound Name | 5-[[4,5-dihydroxy-5-(4-nitrophenyl)pentan-2-yl]-sulfinatoamino]-7-phenylisoquinoline |
|---|---|
| PubChem CID | 90937322 |
| Molecular Formula | C26H24N3O6S- |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 5-[[4,5-dihydroxy-5-(4-nitrophenyl)pentan-2-yl]-sulfinatoamino]-7-phenylisoquinoline |
| SMILES | CC(CC(O)C(O)c1ccc([N+](=O)[O-])cc1)N(c1cc(-c2ccccc2)cc2cnccc12)S(=O)[O-] |
| InChI | InChI=1S/C26H25N3O6S/c1-17(13-25(30)26(31)19-7-9-22(10-8-19)29(32)33)28(36(34)35)24-15-20(18-5-3-2-4-6-18)14-21-16-27-12-11-23(21)24/h2-12,14-17,25-26,30-31H,13H2,1H3,(H,34,35)/p-1 |
| InChIKey | QOZBTMWKTPYEPG-UHFFFAOYSA-M |
| XLogP | 4.28 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|