C28H43N3OS — CID 87780982
(3aS,3bS,9aR,9bR,11aS)-1-[2-(hexylamino)-1,3-thiazol-4-yl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 87780982) has the molecular formula C28H43N3OS and a molecular weight of 469.74 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-1-[2-(hexylamino)-1,3-thiazol-4-yl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-1-[2-(hexylamino)-1,3-thiazol-4-yl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 87780982 |
| Molecular Formula | C28H43N3OS |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-1-[2-(hexylamino)-1,3-thiazol-4-yl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CCCCCCNc1nc(C2CC[C@H]3[C@@H]4CCC5N(C)C(=O)C=C[C@]5(C)[C@@H]4CC[C@]23C)cs1 |
| InChI | InChI=1S/C28H43N3OS/c1-5-6-7-8-17-29-26-30-23(18-33-26)22-11-10-20-19-9-12-24-28(3,16-14-25(32)31(24)4)21(19)13-15-27(20,22)2/h14,16,18-22,24H,5-13,15,17H2,1-4H3,(H,29,30)/t19-,20-,21+,22?,24?,27-,28+/m0/s1 |
| InChIKey | JDIAIPJZVPOBBV-OPYGJRTQSA-N |
| XLogP | 6.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|