C22H22ClFN4O2S — CID 87781131
N-[(4-chlorophenyl)methyl]-8-[(4-fluorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide (PubChem CID 87781131) has the molecular formula C22H22ClFN4O2S and a molecular weight of 460.96 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-[(4-fluorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-[(4-fluorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
|---|---|
| PubChem CID | 87781131 |
| Molecular Formula | C22H22ClFN4O2S |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-[(4-fluorophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1=NOC2(CCN(C(=S)Nc3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C22H22ClFN4O2S/c23-16-3-1-15(2-4-16)14-25-20(29)19-13-22(30-27-19)9-11-28(12-10-22)21(31)26-18-7-5-17(24)6-8-18/h1-8H,9-14H2,(H,25,29)(H,26,31) |
| InChIKey | LHQTYNZYHBCOKS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|