C21H29ClN4O2S — CID 16665192
N-[(4-chlorophenyl)methyl]-8-(pentylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide (PubChem CID 16665192) has the molecular formula C21H29ClN4O2S and a molecular weight of 437.01 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-(pentylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-(pentylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
|---|---|
| PubChem CID | 16665192 |
| Molecular Formula | C21H29ClN4O2S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-(pentylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
| SMILES | CCCCCNC(=S)N1CCC2(CC1)CC(C(=O)NCc1ccc(Cl)cc1)=NO2 |
| InChI | InChI=1S/C21H29ClN4O2S/c1-2-3-4-11-23-20(29)26-12-9-21(10-13-26)14-18(25-28-21)19(27)24-15-16-5-7-17(22)8-6-16/h5-8H,2-4,9-15H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | RQAVBOHFBNNAHA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|