C24H27IN4O4S — CID 87781148
N-[(3,4-dimethoxyphenyl)methyl]-8-[(2-iodophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide (PubChem CID 87781148) has the molecular formula C24H27IN4O4S and a molecular weight of 594.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-8-[(2-iodophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-8-[(2-iodophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
|---|---|
| PubChem CID | 87781148 |
| Molecular Formula | C24H27IN4O4S |
| Molecular Weight | 594.48 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-8-[(2-iodophenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2=NOC3(CCN(C(=S)Nc4ccccc4I)CC3)C2)cc1OC |
| InChI | InChI=1S/C24H27IN4O4S/c1-31-20-8-7-16(13-21(20)32-2)15-26-22(30)19-14-24(33-28-19)9-11-29(12-10-24)23(34)27-18-6-4-3-5-17(18)25/h3-8,13H,9-12,14-15H2,1-2H3,(H,26,30)(H,27,34) |
| InChIKey | PYRFEXGYDQCMGM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|