C28H30N4O5S — CID 91532359
[8-(naphthalen-1-ylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 91532359) has the molecular formula C28H30N4O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is [8-(naphthalen-1-ylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | [8-(naphthalen-1-ylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 91532359 |
| Molecular Formula | C28H30N4O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | [8-(naphthalen-1-ylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)OC2=CC3(CCN(C(=S)Nc4cccc5ccccc45)CC3)ON2)cc1OC |
| InChI | InChI=1S/C28H30N4O5S/c1-34-23-11-10-19(16-24(23)35-2)18-29-27(33)36-25-17-28(37-31-25)12-14-32(15-13-28)26(38)30-22-9-5-7-20-6-3-4-8-21(20)22/h3-11,16-17,31H,12-15,18H2,1-2H3,(H,29,33)(H,30,38) |
| InChIKey | SYXXMYOVDKYPBQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|