C26H38N4O5S — CID 90840555
[8-(cyclooctylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 90840555) has the molecular formula C26H38N4O5S and a molecular weight of 518.68 g/mol. Its IUPAC name is [8-(cyclooctylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | [8-(cyclooctylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 90840555 |
| Molecular Formula | C26H38N4O5S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [8-(cyclooctylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(3,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)OC2=CC3(CCN(C(=S)NC4CCCCCCC4)CC3)ON2)cc1OC |
| InChI | InChI=1S/C26H38N4O5S/c1-32-21-11-10-19(16-22(21)33-2)18-27-25(31)34-23-17-26(35-29-23)12-14-30(15-13-26)24(36)28-20-8-6-4-3-5-7-9-20/h10-11,16-17,20,29H,3-9,12-15,18H2,1-2H3,(H,27,31)(H,28,36) |
| InChIKey | ITUYHLDCULKCGR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|