C27H42N4O3S2 — CID 87781457
propan-2-yl (4R)-4-[[(2R)-1-[2-(benzylamino)ethylamino]-4-cyclohexyl-1-sulfanylidenebutan-2-yl]carbamoyl]-1,3-thiazolidine-3-carboxylate (PubChem CID 87781457) has the molecular formula C27H42N4O3S2 and a molecular weight of 534.79 g/mol. Its IUPAC name is propan-2-yl (4R)-4-[[(2R)-1-[2-(benzylamino)ethylamino]-4-cyclohexyl-1-sulfanylidenebutan-2-yl]carbamoyl]-1,3-thiazolidine-3-carboxylate.
| Compound Name | propan-2-yl (4R)-4-[[(2R)-1-[2-(benzylamino)ethylamino]-4-cyclohexyl-1-sulfanylidenebutan-2-yl]carbamoyl]-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 87781457 |
| Molecular Formula | C27H42N4O3S2 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | propan-2-yl (4R)-4-[[(2R)-1-[2-(benzylamino)ethylamino]-4-cyclohexyl-1-sulfanylidenebutan-2-yl]carbamoyl]-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)OC(=O)N1CSC[C@H]1C(=O)N[C@H](CCC1CCCCC1)C(=S)NCCNCc1ccccc1 |
| InChI | InChI=1S/C27H42N4O3S2/c1-20(2)34-27(33)31-19-36-18-24(31)25(32)30-23(14-13-21-9-5-3-6-10-21)26(35)29-16-15-28-17-22-11-7-4-8-12-22/h4,7-8,11-12,20-21,23-24,28H,3,5-6,9-10,13-19H2,1-2H3,(H,29,35)(H,30,32)/t23-,24+/m1/s1 |
| InChIKey | NCJOUMWTUFNLCQ-RPWUZVMVSA-N |
| XLogP | 4.46 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|