C23H34N2O2S2 — CID 87824143
(3R)-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]thiolane-3-carboxamide (PubChem CID 87824143) has the molecular formula C23H34N2O2S2 and a molecular weight of 434.67 g/mol. Its IUPAC name is (3R)-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]thiolane-3-carboxamide.
| Compound Name | (3R)-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 87824143 |
| Molecular Formula | C23H34N2O2S2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3R)-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]thiolane-3-carboxamide |
| SMILES | COc1ccc(CNC(=S)[C@@H](CCC2CCCCC2)NC(=O)[C@H]2CCSC2)cc1 |
| InChI | InChI=1S/C23H34N2O2S2/c1-27-20-10-7-18(8-11-20)15-24-23(28)21(12-9-17-5-3-2-4-6-17)25-22(26)19-13-14-29-16-19/h7-8,10-11,17,19,21H,2-6,9,12-16H2,1H3,(H,24,28)(H,25,26)/t19-,21+/m0/s1 |
| InChIKey | NAJFSGIVUWEFPB-PZJWPPBQSA-N |
| XLogP | 4.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|