C25H38N2O5S — CID 87823631
(2R)-2-amino-3-cyclohexyl-2-(cyclohexylmethylsulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide (PubChem CID 87823631) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is (2R)-2-amino-3-cyclohexyl-2-(cyclohexylmethylsulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide.
| Compound Name | (2R)-2-amino-3-cyclohexyl-2-(cyclohexylmethylsulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 87823631 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (2R)-2-amino-3-cyclohexyl-2-(cyclohexylmethylsulfonylmethyl)-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide |
| SMILES | COc1ccc(CNC(=O)[C@@](N)(CS(=O)(=O)CC2CCCCC2)C(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H38N2O5S/c1-32-22-14-12-19(13-15-22)16-27-24(29)25(26,23(28)21-10-6-3-7-11-21)18-33(30,31)17-20-8-4-2-5-9-20/h12-15,20-21H,2-11,16-18,26H2,1H3,(H,27,29)/t25-/m1/s1 |
| InChIKey | IBVUUUZNLSEDRK-RUZDIDTESA-N |
| XLogP | 3.15 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|