C25H38N2O4 — CID 87823722
(2R)-2-[amino(cyclohexylmethoxy)methyl]-3-cyclohexyl-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide (PubChem CID 87823722) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2R)-2-[amino(cyclohexylmethoxy)methyl]-3-cyclohexyl-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide.
| Compound Name | (2R)-2-[amino(cyclohexylmethoxy)methyl]-3-cyclohexyl-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 87823722 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (2R)-2-[amino(cyclohexylmethoxy)methyl]-3-cyclohexyl-N-[(4-methoxyphenyl)methyl]-3-oxopropanamide |
| SMILES | COc1ccc(CNC(=O)[C@@H](C(=O)C2CCCCC2)C(N)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H38N2O4/c1-30-21-14-12-18(13-15-21)16-27-25(29)22(23(28)20-10-6-3-7-11-20)24(26)31-17-19-8-4-2-5-9-19/h12-15,19-20,22,24H,2-11,16-17,26H2,1H3,(H,27,29)/t22-,24?/m0/s1 |
| InChIKey | XGKNTEAYUISIBD-OWJIYDKWSA-N |
| XLogP | 3.96 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|