C25H39N3O2S — CID 87824026
4-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]cyclohexane-1-carboxamide (PubChem CID 87824026) has the molecular formula C25H39N3O2S and a molecular weight of 445.67 g/mol. Its IUPAC name is 4-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87824026 |
| Molecular Formula | C25H39N3O2S |
| Molecular Weight | 445.67 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 4-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(CNC(=S)[C@@H](CCC2CCCCC2)NC(=O)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C25H39N3O2S/c1-30-22-14-7-19(8-15-22)17-27-25(31)23(16-9-18-5-3-2-4-6-18)28-24(29)20-10-12-21(26)13-11-20/h7-8,14-15,18,20-21,23H,2-6,9-13,16-17,26H2,1H3,(H,27,31)(H,28,29)/t20?,21?,23-/m1/s1 |
| InChIKey | JXESXYGCOGBQFZ-YDPRHXJPSA-N |
| XLogP | 4.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|