C22H30N4O2S2 — CID 87822915
2-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 87822915) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 87822915 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-amino-N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(CNC(=S)[C@@H](CCC2CCCCC2)NC(=O)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C22H30N4O2S2/c1-28-17-10-7-16(8-11-17)13-24-21(29)18(12-9-15-5-3-2-4-6-15)25-20(27)19-14-30-22(23)26-19/h7-8,10-11,14-15,18H,2-6,9,12-13H2,1H3,(H2,23,26)(H,24,29)(H,25,27)/t18-/m1/s1 |
| InChIKey | UMRPKTJZZVJAMQ-GOSISDBHSA-N |
| XLogP | 4.31 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|