C19H23N3O3S — CID 60615148
2-acetamido-N-[(4-cyclohexyloxyphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 60615148) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-acetamido-N-[(4-cyclohexyloxyphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[(4-cyclohexyloxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 60615148 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-acetamido-N-[(4-cyclohexyloxyphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)NCc2ccc(OC3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C19H23N3O3S/c1-13(23)21-19-22-17(12-26-19)18(24)20-11-14-7-9-16(10-8-14)25-15-5-3-2-4-6-15/h7-10,12,15H,2-6,11H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | GAQJBPVILWQCNY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |