C15H16N6O5S — CID 87182652
[[4-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]phenyl]methylcarbamoylamino]carbamic acid (PubChem CID 87182652) has the molecular formula C15H16N6O5S and a molecular weight of 392.40 g/mol. Its IUPAC name is [[4-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]phenyl]methylcarbamoylamino]carbamic acid.
| Compound Name | [[4-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]phenyl]methylcarbamoylamino]carbamic acid |
|---|---|
| PubChem CID | 87182652 |
| Molecular Formula | C15H16N6O5S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [[4-[(2-acetamido-1,3-thiazole-4-carbonyl)amino]phenyl]methylcarbamoylamino]carbamic acid |
| SMILES | CC(=O)Nc1nc(C(=O)Nc2ccc(CNC(=O)NNC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C15H16N6O5S/c1-8(22)17-14-19-11(7-27-14)12(23)18-10-4-2-9(3-5-10)6-16-13(24)20-21-15(25)26/h2-5,7,21H,6H2,1H3,(H,18,23)(H,25,26)(H2,16,20,24)(H,17,19,22) |
| InChIKey | PLEFSYXHZDRHOB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|