C23H36N2O3S — CID 87822836
2-methylpropyl N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]carbamate (PubChem CID 87822836) has the molecular formula C23H36N2O3S and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-methylpropyl N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87822836 |
| Molecular Formula | C23H36N2O3S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-methylpropyl N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]carbamate |
| SMILES | COc1ccc(CNC(=S)[C@@H](CCC2CCCCC2)NC(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C23H36N2O3S/c1-17(2)16-28-23(26)25-21(14-11-18-7-5-4-6-8-18)22(29)24-15-19-9-12-20(27-3)13-10-19/h9-10,12-13,17-18,21H,4-8,11,14-16H2,1-3H3,(H,24,29)(H,25,26)/t21-/m1/s1 |
| InChIKey | NCNZSCWLVFMNNW-OAQYLSRUSA-N |
| XLogP | 5.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|