C22H33N3O2S2 — CID 87823899
N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazolidine-2-carboxamide (PubChem CID 87823899) has the molecular formula C22H33N3O2S2 and a molecular weight of 435.66 g/mol. Its IUPAC name is N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazolidine-2-carboxamide.
| Compound Name | N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 87823899 |
| Molecular Formula | C22H33N3O2S2 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[(2R)-4-cyclohexyl-1-[(4-methoxyphenyl)methylamino]-1-sulfanylidenebutan-2-yl]-1,3-thiazolidine-2-carboxamide |
| SMILES | COc1ccc(CNC(=S)[C@@H](CCC2CCCCC2)NC(=O)C2NCCS2)cc1 |
| InChI | InChI=1S/C22H33N3O2S2/c1-27-18-10-7-17(8-11-18)15-24-21(28)19(12-9-16-5-3-2-4-6-16)25-20(26)22-23-13-14-29-22/h7-8,10-11,16,19,22-23H,2-6,9,12-15H2,1H3,(H,24,28)(H,25,26)/t19-,22?/m1/s1 |
| InChIKey | NGJOVJIRVXJTFW-LCQOSCCDSA-N |
| XLogP | 3.62 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|