C23H36N2O5S — CID 69414052
tert-butyl (2R)-2-amino-2-(cyclohexylmethylsulfinylmethyl)-3-[(4-methoxyphenyl)methylamino]-3-oxopropanoate (PubChem CID 69414052) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-2-(cyclohexylmethylsulfinylmethyl)-3-[(4-methoxyphenyl)methylamino]-3-oxopropanoate.
| Compound Name | tert-butyl (2R)-2-amino-2-(cyclohexylmethylsulfinylmethyl)-3-[(4-methoxyphenyl)methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69414052 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | tert-butyl (2R)-2-amino-2-(cyclohexylmethylsulfinylmethyl)-3-[(4-methoxyphenyl)methylamino]-3-oxopropanoate |
| SMILES | COc1ccc(CNC(=O)[C@](N)(CS(=O)CC2CCCCC2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H36N2O5S/c1-22(2,3)30-21(27)23(24,16-31(28)15-18-8-6-5-7-9-18)20(26)25-14-17-10-12-19(29-4)13-11-17/h10-13,18H,5-9,14-16,24H2,1-4H3,(H,25,26)/t23-,31?/m1/s1 |
| InChIKey | UWSMZWHEWSKOCH-WNEYBHKTSA-N |
| XLogP | 2.68 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|