C21H29N3OS — CID 87781852
N-(cyclohexylmethyl)-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-8-carbothioamide (PubChem CID 87781852) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-8-carbothioamide.
| Compound Name | N-(cyclohexylmethyl)-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-8-carbothioamide |
|---|---|
| PubChem CID | 87781852 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-(cyclohexylmethyl)-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene-8-carbothioamide |
| SMILES | S=C(NCC1CCCCC1)N1CCC2(CC1)CC(c1ccccc1)=NO2 |
| InChI | InChI=1S/C21H29N3OS/c26-20(22-16-17-7-3-1-4-8-17)24-13-11-21(12-14-24)15-19(23-25-21)18-9-5-2-6-10-18/h2,5-6,9-10,17H,1,3-4,7-8,11-16H2,(H,22,26) |
| InChIKey | VZUJRHOUKRQBJX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|