C12H15FN2O2S — CID 8778267
N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide (PubChem CID 8778267) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8778267 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[(2S)-2-cyano-3-methylbutan-2-yl]-2-fluorobenzenesulfonamide |
| SMILES | CC(C)[C@@](C)(C#N)NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C12H15FN2O2S/c1-9(2)12(3,8-14)15-18(16,17)11-7-5-4-6-10(11)13/h4-7,9,15H,1-3H3/t12-/m1/s1 |
| InChIKey | NXWLXRYLTRKEFJ-GFCCVEGCSA-N |
| XLogP | 2.04 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |